ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52273-60-6 4-(2-chlorethyl)anilin |
|
| Produkt-Name | 4-(2-chlorethyl)anilin |
| Synonyme | ; |
| Englischer Name | 4-(2-chloroethyl)aniline; |
| Molekulare Formel | C8H10ClN |
| Molecular Weight | 155.6247 |
| InChl | InChI=1/C8H10ClN/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6,10H2 |
| CAS Registry Number | 52273-60-6 |
| Molecular Structure | ![]() |
| Dichte | 1.144g/cm3 |
| Siedepunkt | 274.8°C at 760 mmHg |
| Brechungsindex | 1.574 |
| Flammpunkt | 120°C |
| Dampfdruck | 0.0053mmHg at 25°C |
| MSDS | |