ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52273-60-6 4-(2-chloorethyl)aniline |
|
| Naam product | 4-(2-chloorethyl)aniline |
| Synoniemen | ; |
| Engelse naam | 4-(2-chloroethyl)aniline; |
| MF | C8H10ClN |
| Molecuulgewicht | 155.6247 |
| InChI | InChI=1/C8H10ClN/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6,10H2 |
| CAS-nummer | 52273-60-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.144g/cm3 |
| Kookpunt | 274.8°C at 760 mmHg |
| Brekingsindex | 1.574 |
| Vlampunt | 120°C |
| Dampdruk | 0.0053mmHg at 25°C |
| MSDS | |