ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52364-71-3 4'-(pentyloxy)-4-biphenylcarbonitrile |
|
| Produkt-Name | 4'-(pentyloxy)-4-biphenylcarbonitrile |
| Englischer Name | 4'-(pentyloxy)-4-biphenylcarbonitrile;4-Cyano-4-n-pentyloxybiphenyl;4-Pentyloxy-4-cyano biphenyl;4'-(pentyloxy)biphenyl-4-carbonitrile;4-Pentyloxy-[1,1'-Biphenyl]-4'-Carbonitrile;4'-(pentyloxy)-[1,1'-biphenyl]-4-carbonitrile |
| Molekulare Formel | C18H19NO |
| Molecular Weight | 265.3496 |
| InChl | InChI=1/C18H19NO/c1-2-3-4-13-20-18-11-9-17(10-12-18)16-7-5-15(14-19)6-8-16/h5-12H,2-4,13H2,1H3 |
| CAS Registry Number | 52364-71-3 |
| EINECS | 257-875-9 |
| Molecular Structure | ![]() |
| Dichte | 1.07g/cm3 |
| Siedepunkt | 418°C at 760 mmHg |
| Brechungsindex | 1.567 |
| Flammpunkt | 175.3°C |
| Dampfdruck | 3.39E-07mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R20/21/22||R36/37/38:; |
| Safety Beschreibung | S26||S36:; |
| MSDS | |