ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52364-71-3 4'-(pentyloxy)-4-biphenylcarbonitrile |
|
| اسم المنتج | 4'-(pentyloxy)-4-biphenylcarbonitrile |
| الاسم بالانجليزية | 4'-(pentyloxy)-4-biphenylcarbonitrile;4-Cyano-4-n-pentyloxybiphenyl;4-Pentyloxy-4-cyano biphenyl;4'-(pentyloxy)biphenyl-4-carbonitrile;4-Pentyloxy-[1,1'-Biphenyl]-4'-Carbonitrile;4'-(pentyloxy)-[1,1'-biphenyl]-4-carbonitrile |
| الصيغة الجزيئية | C18H19NO |
| الوزن الجزيئي الغرامي | 265.3496 |
| InChI | InChI=1/C18H19NO/c1-2-3-4-13-20-18-11-9-17(10-12-18)16-7-5-15(14-19)6-8-16/h5-12H,2-4,13H2,1H3 |
| إستراتيجية المساعدة القطرية | 52364-71-3 |
| المفوضية الأوروبية رقم | 257-875-9 |
| بنية جزيئية | ![]() |
| كثافة | 1.07g/cm3 |
| نقطة الغليان | 418°C at 760 mmHg |
| معامل الإنكسار | 1.567 |
| نقطة الوميض | 175.3°C |
| ضغط البخار | 3.39E-07mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R20/21/22||R36/37/38:; |
| شروط الأمن | S26||S36:; |
| MSDS | |