ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-88-6 4-Dimethylamino-2-methylazobenzol |
|
| Produkt-Name | 4-Dimethylamino-2-methylazobenzol |
| Synonyme | N,N-Dimethyl-4-phenylazo-m-toluidin; N,N,3-Trimethyl-4-[(E)-phenyldiazenyl]anilin; |
| Englischer Name | 4-Dimethylamino-2-methylazobenzene;N,N-Dimethyl-4-phenylazo-m-toluidine;N,N,3-trimethyl-4-[(E)-phenyldiazenyl]aniline |
| Molekulare Formel | C15H17N3 |
| Molecular Weight | 239.3156 |
| InChl | InChI=1/C15H17N3/c1-12-11-14(18(2)3)9-10-15(12)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3/b17-16+ |
| CAS Registry Number | 54-88-6 |
| EINECS | 200-217-2 |
| Molecular Structure | ![]() |
| Dichte | 1.01g/cm3 |
| Schmelzpunkt | 65-68℃ |
| Siedepunkt | 390.9°C at 760 mmHg |
| Brechungsindex | 1.561 |
| Flammpunkt | 190.2°C |
| Dampfdruck | 2.57E-06mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |