ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-88-6 4-dimethylamino-2-methylazobenzeen |
|
| Naam product | 4-dimethylamino-2-methylazobenzeen |
| Synoniemen | N,N-dimethyl-4-fenylazo-m-toluïdine; N,N,3-trimethyl-4-[(E)-fenyldiazenyl]aniline; |
| Engelse naam | 4-Dimethylamino-2-methylazobenzene;N,N-Dimethyl-4-phenylazo-m-toluidine;N,N,3-trimethyl-4-[(E)-phenyldiazenyl]aniline |
| MF | C15H17N3 |
| Molecuulgewicht | 239.3156 |
| InChI | InChI=1/C15H17N3/c1-12-11-14(18(2)3)9-10-15(12)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3/b17-16+ |
| CAS-nummer | 54-88-6 |
| EINECS | 200-217-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.01g/cm3 |
| Smeltpunt | 65-68℃ |
| Kookpunt | 390.9°C at 760 mmHg |
| Brekingsindex | 1.561 |
| Vlampunt | 190.2°C |
| Dampdruk | 2.57E-06mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |