ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
544-47-8 S-(4-Chlorobenzyl)thiuronium chloride |
|
Produkt-Name | S-(4-Chlorobenzyl)thiuronium chloride |
Englischer Name | S-(4-Chlorobenzyl)thiuronium chloride;2-(4-Chlorobenzyl)-2-thiopseudourea hydrochloride;S-(4-Chlorobenzyl)isothiouronium chloride;S-(p-Chlorobenzyl)-thiouronium chloride;4-chlorobenzyl carbamimidothioate hydrochloride (1:1);4-chlorobenzyl carbamimidothioate;amino[(4-chlorobenzyl)sulfanyl]methaniminium |
Molekulare Formel | C8H10ClN2S |
Molecular Weight | 201.6959 |
InChl | InChI=1/C8H9ClN2S/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5H2,(H3,10,11)/p+1 |
CAS Registry Number | 544-47-8 |
EINECS | 208-871-0 |
Molecular Structure | ![]() |
Schmelzpunkt | 205-208℃ |
Siedepunkt | 315.9°C at 760 mmHg |
Flammpunkt | 144.9°C |
Dampfdruck | 0.000423mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |