ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
544-47-8 S-(4-Chlorobenzyl)thiuronium chloride |
|
상품명칭 | S-(4-Chlorobenzyl)thiuronium chloride |
영문 이름 | S-(4-Chlorobenzyl)thiuronium chloride;2-(4-Chlorobenzyl)-2-thiopseudourea hydrochloride;S-(4-Chlorobenzyl)isothiouronium chloride;S-(p-Chlorobenzyl)-thiouronium chloride;4-chlorobenzyl carbamimidothioate hydrochloride (1:1);4-chlorobenzyl carbamimidothioate;amino[(4-chlorobenzyl)sulfanyl]methaniminium |
분자식 | C8H10ClN2S |
분자량 | 201.6959 |
InChI | InChI=1/C8H9ClN2S/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5H2,(H3,10,11)/p+1 |
cas번호 | 544-47-8 |
EC번호 | 208-871-0 |
분자 구조 | ![]() |
녹는 점 | 205-208℃ |
비등점 | 315.9°C at 760 mmHg |
인화점 | 144.9°C |
증기압 | 0.000423mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |