ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54647-77-7 N-[(Benzyloxy)carbonyl]-L-valin, Verbindung mit Dicyclohexylamin (1:1) |
|
| Produkt-Name | N-[(Benzyloxy)carbonyl]-L-valin, Verbindung mit Dicyclohexylamin (1:1) |
| Synonyme | N-((Benzyloxy)carbonyl)-L-valin, Verbindung mit Dicyclohexylamin (1:1); N-[(Benzyloxy)carbonyl]valin-N-Cyclohexylcyclohexanamin (1:1); |
| Englischer Name | N-[(benzyloxy)carbonyl]-L-valine, compound with dicyclohexylamine (1:1);N-((Benzyloxy)carbonyl)-L-valine, compound with dicyclohexylamine (1:1);N-[(benzyloxy)carbonyl]valine - N-cyclohexylcyclohexanamine (1:1) |
| Molekulare Formel | C25H40N2O4 |
| Molecular Weight | 432.5961 |
| InChl | InChI=1/C13H17NO4.C12H23N/c1-9(2)11(12(15)16)14-13(17)18-8-10-6-4-3-5-7-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-7,9,11H,8H2,1-2H3,(H,14,17)(H,15,16);11-13H,1-10H2 |
| CAS Registry Number | 54647-77-7 |
| EINECS | 259-274-7 |
| Molecular Structure | ![]() |
| Siedepunkt | 432.6°C at 760 mmHg |
| Flammpunkt | 215.4°C |
| Dampfdruck | 2.99E-08mmHg at 25°C |
| MSDS | |