ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54647-77-7 N-[(benzyloxy)carbonyl]-L-valine, תרכובת עם dicyclohexylamine (1: 1) |
|
| שם המוצר | N-[(benzyloxy)carbonyl]-L-valine, תרכובת עם dicyclohexylamine (1: 1) |
| נרדפות | N-((בנזילוקסי)קרבוניל)-L-ואלין, תרכובת עם dicyclohexylamine (1: 1); N-[(benzyloxy)carbonyl]valine - N-cyclohexylcyclohexanamine (1: 1); |
| שם אנגלי | N-[(benzyloxy)carbonyl]-L-valine, compound with dicyclohexylamine (1:1);N-((Benzyloxy)carbonyl)-L-valine, compound with dicyclohexylamine (1:1);N-[(benzyloxy)carbonyl]valine - N-cyclohexylcyclohexanamine (1:1) |
| מולקולרית פורמולה | C25H40N2O4 |
| משקל מולקולרי | 432.5961 |
| InChl | InChI=1/C13H17NO4.C12H23N/c1-9(2)11(12(15)16)14-13(17)18-8-10-6-4-3-5-7-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-7,9,11H,8H2,1-2H3,(H,14,17)(H,15,16);11-13H,1-10H2 |
| מספר CAS | 54647-77-7 |
| EINECS | 259-274-7 |
| מבנה מולקולרי | ![]() |
| נקודת רתיחה | 432.6°C at 760 mmHg |
| נקודת הבזק | 215.4°C |
| לחץ אדים | 2.99E-08mmHg at 25°C |
| MSDS | |