ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55577-67-8 4-Methoxy-N-[(E)-2-nitro-1-phenylethenyl]anilin |
|
| Produkt-Name | 4-Methoxy-N-[(E)-2-nitro-1-phenylethenyl]anilin |
| Synonyme | ; |
| Englischer Name | 4-methoxy-N-[(E)-2-nitro-1-phenylethenyl]aniline; |
| Molekulare Formel | C15H14N2O3 |
| Molecular Weight | 270.2833 |
| InChl | InChI=1/C15H14N2O3/c1-20-14-9-7-13(8-10-14)16-15(11-17(18)19)12-5-3-2-4-6-12/h2-11,16H,1H3/b15-11+ |
| CAS Registry Number | 55577-67-8 |
| Molecular Structure | ![]() |
| Dichte | 1.24g/cm3 |
| Siedepunkt | 421.8°C at 760 mmHg |
| Brechungsindex | 1.635 |
| Flammpunkt | 208.9°C |
| Dampfdruck | 2.54E-07mmHg at 25°C |
| MSDS | |