ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55577-67-8 4-méthoxy-N-[(E)-2-nitro-1-phényléthényl]aniline |
|
| Nom | 4-méthoxy-N-[(E)-2-nitro-1-phényléthényl]aniline |
| Nom anglais | 4-methoxy-N-[(E)-2-nitro-1-phenylethenyl]aniline; |
| Formule moléculaire | C15H14N2O3 |
| Poids Moléculaire | 270.2833 |
| InChl | InChI=1/C15H14N2O3/c1-20-14-9-7-13(8-10-14)16-15(11-17(18)19)12-5-3-2-4-6-12/h2-11,16H,1H3/b15-11+ |
| Numéro de registre CAS | 55577-67-8 |
| Structure moléculaire | ![]() |
| Densité | 1.24g/cm3 |
| Point d'ébullition | 421.8°C at 760 mmHg |
| Indice de réfraction | 1.635 |
| Point d'éclair | 208.9°C |
| Pression de vapeur | 2.54E-07mmHg at 25°C |
| MSDS | |