ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56247-94-0 4-decyl-1,2,3,6,7,8-hexahydropyrene |
|
| Produkt-Name | 4-decyl-1,2,3,6,7,8-hexahydropyrene |
| Englischer Name | 4-decyl-1,2,3,6,7,8-hexahydropyrene;Pyrene, 4-decyl-1,2,3,6,7,8-hexahydro- |
| Molekulare Formel | C26H36 |
| Molecular Weight | 348.564 |
| InChl | InChI=1/C26H36/c1-2-3-4-5-6-7-8-9-12-22-19-23-15-10-13-20-17-18-21-14-11-16-24(22)26(21)25(20)23/h17-19H,2-16H2,1H3 |
| CAS Registry Number | 56247-94-0 |
| Molecular Structure | ![]() |
| Dichte | 1.005g/cm3 |
| Siedepunkt | 504.9°C at 760 mmHg |
| Brechungsindex | 1.578 |
| Flammpunkt | 296.7°C |
| Dampfdruck | 7.98E-10mmHg at 25°C |
| MSDS | |