ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56247-94-0 4-decyl-1,2,3,6,7,8-hexahydropyrene |
|
| 상품명칭 | 4-decyl-1,2,3,6,7,8-hexahydropyrene |
| 영문 이름 | 4-decyl-1,2,3,6,7,8-hexahydropyrene;Pyrene, 4-decyl-1,2,3,6,7,8-hexahydro- |
| 분자식 | C26H36 |
| 분자량 | 348.564 |
| InChI | InChI=1/C26H36/c1-2-3-4-5-6-7-8-9-12-22-19-23-15-10-13-20-17-18-21-14-11-16-24(22)26(21)25(20)23/h17-19H,2-16H2,1H3 |
| cas번호 | 56247-94-0 |
| 분자 구조 | ![]() |
| 밀도 | 1.005g/cm3 |
| 비등점 | 504.9°C at 760 mmHg |
| 굴절 지수 | 1.578 |
| 인화점 | 296.7°C |
| 증기압 | 7.98E-10mmHg at 25°C |
| MSDS | |