ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59694-46-1 4,5,6-trihydroxy-9-phenyl-3H-xanthen-3-on |
|
| Produkt-Name | 4,5,6-trihydroxy-9-phenyl-3H-xanthen-3-on |
| Synonyme | 3H-xanthen-3-on, 4,5,6-trihydroxy-9-phenyl- |
| Englischer Name | 4,5,6-trihydroxy-9-phenyl-3H-xanthen-3-one;3H-xanthen-3-one, 4,5,6-trihydroxy-9-phenyl- |
| Molekulare Formel | C19H12O5 |
| Molecular Weight | 320.3 |
| InChl | InChI=1/C19H12O5/c20-13-8-6-11-15(10-4-2-1-3-5-10)12-7-9-14(21)17(23)19(12)24-18(11)16(13)22/h1-9,20,22-23H |
| CAS Registry Number | 59694-46-1 |
| Molecular Structure | ![]() |
| Dichte | 1.59g/cm3 |
| Siedepunkt | 612.7°C at 760 mmHg |
| Brechungsindex | 1.791 |
| Flammpunkt | 230.2°C |
| Dampfdruck | 7.22E-16mmHg at 25°C |
| MSDS | |