ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59694-46-1 4,5,6-tri-hidroxi-9-fenil-3H-xanteno-3-ona |
|
| Nome do produto | 4,5,6-tri-hidroxi-9-fenil-3H-xanteno-3-ona |
| Sinônimos | 4,5,6-tri-hidroxi-9-fenil-3-3-ona-3H-xanteno |
| Nome em inglês | 4,5,6-trihydroxy-9-phenyl-3H-xanthen-3-one;3H-xanthen-3-one, 4,5,6-trihydroxy-9-phenyl- |
| Fórmula molecular | C19H12O5 |
| Peso Molecular | 320.3 |
| InChI | InChI=1/C19H12O5/c20-13-8-6-11-15(10-4-2-1-3-5-10)12-7-9-14(21)17(23)19(12)24-18(11)16(13)22/h1-9,20,22-23H |
| CAS Registry Number | 59694-46-1 |
| Estrutura Molecular | ![]() |
| Densidade | 1.59g/cm3 |
| Ponto de ebulição | 612.7°C at 760 mmHg |
| índice de refração | 1.791 |
| O ponto de inflamação | 230.2°C |
| Pressão de vapor | 7.22E-16mmHg at 25°C |
| MSDS | |