ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-02-7 o-Tolyl benzoate |
|
| Produkt-Name | o-Tolyl benzoate |
| Englischer Name | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
| Molekulare Formel | C14H12O2 |
| Molecular Weight | 212.2439 |
| InChl | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
| CAS Registry Number | 617-02-7 |
| EINECS | 210-501-8 |
| Molecular Structure | ![]() |
| Dichte | 1.122g/cm3 |
| Siedepunkt | 368.9°C at 760 mmHg |
| Brechungsindex | 1.577 |
| Flammpunkt | 154.5°C |
| Dampfdruck | 1.23E-05mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |