ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 617-02-7 o-Tolyl benzoate | |
| Nom | o-Tolyl benzoate | 
| Nom anglais | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate | 
| Formule moléculaire | C14H12O2 | 
| Poids Moléculaire | 212.2439 | 
| InChl | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 | 
| Numéro de registre CAS | 617-02-7 | 
| EINECS | 210-501-8 | 
| Structure moléculaire |  | 
| Densité | 1.122g/cm3 | 
| Point d'ébullition | 368.9°C at 760 mmHg | 
| Indice de réfraction | 1.577 | 
| Point d'éclair | 154.5°C | 
| Pression de vapeur | 1.23E-05mmHg at 25°C | 
| Description de sécurité | S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |