ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
62319-53-3 (2R,3E,5R)-3-(2-hydroxyethyliden)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-2-carbonsäure |
|
| Produkt-Name | (2R,3E,5R)-3-(2-hydroxyethyliden)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-2-carbonsäure |
| Synonyme | ; |
| Englischer Name | (2R,3E,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; |
| Molekulare Formel | C8H9NO5 |
| Molecular Weight | 199.1608 |
| InChl | InChI=1/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1+/t6-,7-/m1/s1 |
| CAS Registry Number | 62319-53-3;85-53-0 |
| Molecular Structure | ![]() |
| Dichte | 1.65g/cm3 |
| Siedepunkt | 545.8°C at 760 mmHg |
| Brechungsindex | 1.644 |
| Flammpunkt | 283.9°C |
| Dampfdruck | 3.45E-14mmHg at 25°C |
| MSDS | |