ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
62319-53-3 (2R,3E,5R)-3-(2-hydroxyethylideen)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptaan-2-carbonzuur |
|
| Naam product | (2R,3E,5R)-3-(2-hydroxyethylideen)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptaan-2-carbonzuur |
| Synoniemen | ; |
| Engelse naam | (2R,3E,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; |
| MF | C8H9NO5 |
| Molecuulgewicht | 199.1608 |
| InChI | InChI=1/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1+/t6-,7-/m1/s1 |
| CAS-nummer | 62319-53-3;85-53-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.65g/cm3 |
| Kookpunt | 545.8°C at 760 mmHg |
| Brekingsindex | 1.644 |
| Vlampunt | 283.9°C |
| Dampdruk | 3.45E-14mmHg at 25°C |
| MSDS | |