ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71902-25-5 Phenol, octenyliert |
|
| Produkt-Name | Phenol, octenyliert |
| Synonyme | Phenol, Reaktionsprodukt mit Octen |
| Englischer Name | Phenol, octenylated;Phenol, reaction product with octene |
| Molekulare Formel | C14H22O |
| Molecular Weight | 206.3268 |
| InChl | InChI=1/C14H22O/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12,15H,2-8H2,1H3 |
| CAS Registry Number | 71902-25-5 |
| EINECS | 276-174-9 |
| Molecular Structure | ![]() |
| MSDS | |