ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71902-25-5 Fenol, verachtzaamd |
|
| Naam product | Fenol, verachtzaamd |
| Synoniemen | Fenol, reactieproduct met octeen |
| Engelse naam | Phenol, octenylated;Phenol, reaction product with octene |
| MF | C14H22O |
| Molecuulgewicht | 206.3268 |
| InChI | InChI=1/C14H22O/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12,15H,2-8H2,1H3 |
| CAS-nummer | 71902-25-5 |
| EINECS | 276-174-9 |
| Moleculaire Structuur | ![]() |
| MSDS | |