ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73330-91-3 Methylcyclopropylcarbamat |
|
Produkt-Name | Methylcyclopropylcarbamat |
Synonyme | ; Cyclopropylcarbaminsäuremethylester; |
Englischer Name | Methyl cyclopropylcarbamate;Cyclopropylcarbamic acid methyl ester |
Molekulare Formel | C5H9NO2 |
Molecular Weight | 115.1305 |
InChl | InChI=1/C5H9NO2/c1-8-5(7)6-4-2-3-4/h4H,2-3H2,1H3,(H,6,7) |
CAS Registry Number | 73330-91-3 |
Molecular Structure | ![]() |
Dichte | 1.1g/cm3 |
Siedepunkt | 188.7°C at 760 mmHg |
Brechungsindex | 1.46 |
Flammpunkt | 67.9°C |
Dampfdruck | 0.592mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |