Chemindex > 73330-91-3
NL â–¼
73330-91-3 Methylcyclopropylcarbamaat |
|
| Naam product | Methylcyclopropylcarbamaat |
| Synoniemen | Cyclopropylcarbamic zure methylester; |
| Engelse naam | Methyl cyclopropylcarbamate;Cyclopropylcarbamic acid methyl ester |
| MF | C5H9NO2 |
| Molecuulgewicht | 115.1305 |
| InChI | InChI=1/C5H9NO2/c1-8-5(7)6-4-2-3-4/h4H,2-3H2,1H3,(H,6,7) |
| CAS-nummer | 73330-91-3 |
| Moleculaire Structuur |  |
| Dichtheid | 1.1g/cm3 |
| Kookpunt | 188.7°C at 760 mmHg |
| Brekingsindex | 1.46 |
| Vlampunt | 67.9°C |
| Dampdruk | 0.592mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 73330-91-3 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 