ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
80-71-7 3-Methyl-1,2-cyclopentanedione |
|
| Produkt-Name | 3-Methyl-1,2-cyclopentanedione |
| Englischer Name | 3-Methyl-1,2-cyclopentanedione;2-Hydroxy-3-methyl-2-cyclopenten-1-one;3-Methylcyclopentane-1,2-dione;(3S)-3-methylcyclopentane-1,2-dione;(3R)-3-methylcyclopentane-1,2-dione;Maple Lactone;2-hydroxy-3-methylcyclopent-2-enone;Methylcyclopentenolone;Methyl cyclopentenolone;Methyl cyclopentenlone |
| Molekulare Formel | C6H8O2 |
| Molecular Weight | 112.1265 |
| InChl | InChI=1/C6H8O2/c1-4-2-3-5(7)6(4)8/h4H,2-3H2,1H3/t4-/m1/s1 |
| CAS Registry Number | 80-71-7;765-70-8 |
| EINECS | 212-154-8;201-303-2 |
| Molecular Structure | ![]() |
| Dichte | 1.102g/cm3 |
| Schmelzpunkt | 105-110℃ |
| Siedepunkt | 178.7°C at 760 mmHg |
| Brechungsindex | 1.463 |
| Flammpunkt | 59.3°C |
| Wasserlöslichkeit | soluble |
| Dampfdruck | 0.978mmHg at 25°C |
| Safety Beschreibung | S24/25:; |
| MSDS | |