ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
80-71-7 3-Methyl-1,2-cyclopentanedione |
|
| Nom | 3-Methyl-1,2-cyclopentanedione |
| Nom anglais | 3-Methyl-1,2-cyclopentanedione;2-Hydroxy-3-methyl-2-cyclopenten-1-one;3-Methylcyclopentane-1,2-dione;(3S)-3-methylcyclopentane-1,2-dione;(3R)-3-methylcyclopentane-1,2-dione;Maple Lactone;2-hydroxy-3-methylcyclopent-2-enone;Methylcyclopentenolone;Methyl cyclopentenolone;Methyl cyclopentenlone |
| Formule moléculaire | C6H8O2 |
| Poids Moléculaire | 112.1265 |
| InChl | InChI=1/C6H8O2/c1-4-2-3-5(7)6(4)8/h4H,2-3H2,1H3/t4-/m1/s1 |
| Numéro de registre CAS | 80-71-7;765-70-8 |
| EINECS | 212-154-8;201-303-2 |
| Structure moléculaire | ![]() |
| Densité | 1.102g/cm3 |
| Point de fusion | 105-110℃ |
| Point d'ébullition | 178.7°C at 760 mmHg |
| Indice de réfraction | 1.463 |
| Point d'éclair | 59.3°C |
| solubilité dans l'eau | soluble |
| Pression de vapeur | 0.978mmHg at 25°C |
| Description de sécurité | S24/25:; |
| MSDS | |