ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-79-8 9,10-dioxo-1-(phenylamino)-9,10-dihydroanthracen-2-carbonsäure |
|
| Produkt-Name | 9,10-dioxo-1-(phenylamino)-9,10-dihydroanthracen-2-carbonsäure |
| Englischer Name | 9,10-dioxo-1-(phenylamino)-9,10-dihydroanthracene-2-carboxylic acid; |
| Molekulare Formel | C21H13NO4 |
| Molecular Weight | 343.3322 |
| InChl | InChI=1/C21H13NO4/c23-19-13-8-4-5-9-14(13)20(24)17-15(19)10-11-16(21(25)26)18(17)22-12-6-2-1-3-7-12/h1-11,22H,(H,25,26) |
| CAS Registry Number | 81-79-8 |
| Molecular Structure | ![]() |
| Dichte | 1.444g/cm3 |
| Siedepunkt | 582.8°C at 760 mmHg |
| Brechungsindex | 1.731 |
| Flammpunkt | 306.3°C |
| Dampfdruck | 2.01E-14mmHg at 25°C |
| MSDS | |