ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-79-8 acide 9,10-dioxo-1-(phénylamino)-9,10-dihydroanthracène-2-carboxylique |
|
| Nom | acide 9,10-dioxo-1-(phénylamino)-9,10-dihydroanthracène-2-carboxylique |
| Synonymes | ; |
| Nom anglais | 9,10-dioxo-1-(phenylamino)-9,10-dihydroanthracene-2-carboxylic acid; |
| Formule moléculaire | C21H13NO4 |
| Poids Moléculaire | 343.3322 |
| InChl | InChI=1/C21H13NO4/c23-19-13-8-4-5-9-14(13)20(24)17-15(19)10-11-16(21(25)26)18(17)22-12-6-2-1-3-7-12/h1-11,22H,(H,25,26) |
| Numéro de registre CAS | 81-79-8 |
| Structure moléculaire | ![]() |
| Densité | 1.444g/cm3 |
| Point d'ébullition | 582.8°C at 760 mmHg |
| Indice de réfraction | 1.731 |
| Point d'éclair | 306.3°C |
| Pression de vapeur | 2.01E-14mmHg at 25°C |
| MSDS | |