ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-11-5 Methyl-2-ethylbutyrat |
|
| Produkt-Name | Methyl-2-ethylbutyrat |
| Synonyme | Methyl-2-ethylbutyrat; Methyl-2-ethylbutanoat; |
| Englischer Name | methyl 2-ethylbutyrate;Methyl 2-ethylbutyrate;methyl 2-ethylbutanoate |
| Molekulare Formel | C7H14O2 |
| Molecular Weight | 130.1849 |
| InChl | InChI=1/C7H14O2/c1-4-6(5-2)7(8)9-3/h6H,4-5H2,1-3H3 |
| CAS Registry Number | 816-11-5 |
| EINECS | 212-428-7 |
| Molecular Structure | ![]() |
| Dichte | 0.879g/cm3 |
| Siedepunkt | 135.1°C at 760 mmHg |
| Brechungsindex | 1.404 |
| Flammpunkt | 33.4°C |
| Dampfdruck | 7.85mmHg at 25°C |
| MSDS | |