ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-11-5 2-etilbutirrato di metile |
|
| Nome del prodotto | 2-etilbutirrato di metile |
| Sinonimi | 2-etilbutirrato di metile; 2-etilbutanoato di metile; |
| Nome inglese | methyl 2-ethylbutyrate;Methyl 2-ethylbutyrate;methyl 2-ethylbutanoate |
| Formula molecolare | C7H14O2 |
| Peso Molecolare | 130.1849 |
| InChI | InChI=1/C7H14O2/c1-4-6(5-2)7(8)9-3/h6H,4-5H2,1-3H3 |
| Numero CAS | 816-11-5 |
| EINECS | 212-428-7 |
| Struttura molecolare | ![]() |
| Densità | 0.879g/cm3 |
| Punto di ebollizione | 135.1°C at 760 mmHg |
| Indice di rifrazione | 1.404 |
| Punto d'infiammabilità | 33.4°C |
| Pressione di vapore | 7.85mmHg at 25°C |
| MSDS | |