ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-75-1 2-amino-2-oxoethyl dimethylcarbamodithioate |
|
| Produkt-Name | 2-amino-2-oxoethyl dimethylcarbamodithioate |
| Englischer Name | 2-amino-2-oxoethyl dimethylcarbamodithioate; |
| Molekulare Formel | C5H10N2OS2 |
| Molecular Weight | 178.2757 |
| InChl | InChI=1/C5H10N2OS2/c1-7(2)5(9)10-3-4(6)8/h3H2,1-2H3,(H2,6,8) |
| CAS Registry Number | 816-75-1 |
| Molecular Structure | ![]() |
| Dichte | 1.291g/cm3 |
| Siedepunkt | 316.9°C at 760 mmHg |
| Brechungsindex | 1.608 |
| Flammpunkt | 145.4°C |
| Dampfdruck | 0.000399mmHg at 25°C |
| MSDS | |