ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-75-1 2-amino-2-oxoethyl dimethylcarbamodithioate |
|
| Nom | 2-amino-2-oxoethyl dimethylcarbamodithioate |
| Nom anglais | 2-amino-2-oxoethyl dimethylcarbamodithioate; |
| Formule moléculaire | C5H10N2OS2 |
| Poids Moléculaire | 178.2757 |
| InChl | InChI=1/C5H10N2OS2/c1-7(2)5(9)10-3-4(6)8/h3H2,1-2H3,(H2,6,8) |
| Numéro de registre CAS | 816-75-1 |
| Structure moléculaire | ![]() |
| Densité | 1.291g/cm3 |
| Point d'ébullition | 316.9°C at 760 mmHg |
| Indice de réfraction | 1.608 |
| Point d'éclair | 145.4°C |
| Pression de vapeur | 0.000399mmHg at 25°C |
| MSDS | |