ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823-22-3 delta-Hexanolactone |
|
| Produkt-Name | delta-Hexanolactone |
| Englischer Name | delta-Hexanolactone;delta-Hexalactone;5-Hydroxyhexanoic acid lactone;6-methyltetrahydro-2H-pyran-2-one;(6S)-6-methyltetrahydro-2H-pyran-2-one |
| Molekulare Formel | C6H10O2 |
| Molecular Weight | 114.1424 |
| InChl | InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
| CAS Registry Number | 823-22-3 |
| EINECS | 212-511-8 |
| Molecular Structure | ![]() |
| Dichte | 1.001g/cm3 |
| Siedepunkt | 215.7°C at 760 mmHg |
| Brechungsindex | 1.43 |
| Flammpunkt | 79.8°C |
| Dampfdruck | 0.145mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |