ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823-22-3 delta-Hexanolactone |
|
| Naam product | delta-Hexanolactone |
| Engelse naam | delta-Hexanolactone;delta-Hexalactone;5-Hydroxyhexanoic acid lactone;6-methyltetrahydro-2H-pyran-2-one;(6S)-6-methyltetrahydro-2H-pyran-2-one |
| MF | C6H10O2 |
| Molecuulgewicht | 114.1424 |
| InChI | InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
| CAS-nummer | 823-22-3 |
| EINECS | 212-511-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.001g/cm3 |
| Kookpunt | 215.7°C at 760 mmHg |
| Brekingsindex | 1.43 |
| Vlampunt | 79.8°C |
| Dampdruk | 0.145mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |