ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-53-4 1,4-Dibromonaphthalene |
|
| Produkt-Name | 1,4-Dibromonaphthalene |
| Englischer Name | 1,4-Dibromonaphthalene;Naphthalene, 1,4-dibromo- |
| Molekulare Formel | C10H6Br2 |
| Molecular Weight | 285.9626 |
| InChl | InChI=1/C10H6Br2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| CAS Registry Number | 83-53-4 |
| EINECS | 201-484-8 |
| Molecular Structure | ![]() |
| Dichte | 1.834g/cm3 |
| Siedepunkt | 334.7°C at 760 mmHg |
| Brechungsindex | 1.688 |
| Flammpunkt | 181.4°C |
| Dampfdruck | 0.000244mmHg at 25°C |
| MSDS | |