ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-53-4 1,4-Dibromonaphthalene |
|
| Naam product | 1,4-Dibromonaphthalene |
| Engelse naam | 1,4-Dibromonaphthalene;Naphthalene, 1,4-dibromo- |
| MF | C10H6Br2 |
| Molecuulgewicht | 285.9626 |
| InChI | InChI=1/C10H6Br2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| CAS-nummer | 83-53-4 |
| EINECS | 201-484-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.834g/cm3 |
| Kookpunt | 334.7°C at 760 mmHg |
| Brekingsindex | 1.688 |
| Vlampunt | 181.4°C |
| Dampdruk | 0.000244mmHg at 25°C |
| MSDS | |