ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-14-6 diethylthiambutene |
|
| Produkt-Name | diethylthiambutene |
| Englischer Name | diethylthiambutene;diethyl(1-methyl-3,3-di-2-thienylallyl)amine;N,N-diethyl-4,4-di(thiophen-2-yl)but-3-en-2-amine |
| Molekulare Formel | C16H21NS2 |
| Molecular Weight | 291.4746 |
| InChl | InChI=1/C16H21NS2/c1-4-17(5-2)13(3)12-14(15-8-6-10-18-15)16-9-7-11-19-16/h6-13H,4-5H2,1-3H3 |
| CAS Registry Number | 86-14-6 |
| EINECS | 205-050-9 |
| Molecular Structure | ![]() |
| Dichte | 1.095g/cm3 |
| Siedepunkt | 399.5°C at 760 mmHg |
| Brechungsindex | 1.582 |
| Flammpunkt | 195.4°C |
| Dampfdruck | 1.36E-06mmHg at 25°C |
| MSDS | |