ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-14-6 diethylthiambutene |
|
| Nazwa produktu: | diethylthiambutene |
| Angielska nazwa | diethylthiambutene;diethyl(1-methyl-3,3-di-2-thienylallyl)amine;N,N-diethyl-4,4-di(thiophen-2-yl)but-3-en-2-amine |
| MF | C16H21NS2 |
| Masie cząsteczkowej | 291.4746 |
| InChI | InChI=1/C16H21NS2/c1-4-17(5-2)13(3)12-14(15-8-6-10-18-15)16-9-7-11-19-16/h6-13H,4-5H2,1-3H3 |
| Nr CAS | 86-14-6 |
| EINECS | 205-050-9 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.095g/cm3 |
| Temperatura wrzenia | 399.5°C at 760 mmHg |
| Współczynnik załamania | 1.582 |
| Temperatura zapłonu | 195.4°C |
| Ciśnienie pary | 1.36E-06mmHg at 25°C |
| MSDS | |