ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-85-4 Hexamethylbenzene |
|
| Produkt-Name | Hexamethylbenzene |
| Englischer Name | Hexamethylbenzene;Mellitene |
| Molekulare Formel | C12H18 |
| Molecular Weight | 162.2713 |
| InChl | InChI=1/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
| CAS Registry Number | 87-85-4 |
| EINECS | 201-777-0 |
| Molecular Structure | ![]() |
| Dichte | 0.867g/cm3 |
| Schmelzpunkt | 165-168℃ |
| Siedepunkt | 256.6°C at 760 mmHg |
| Brechungsindex | 1.501 |
| Flammpunkt | 104.3°C |
| Dampfdruck | 0.0245mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |