ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-85-4 Hexamethylbenzene |
|
| Nome do produto | Hexamethylbenzene |
| Nome em inglês | Hexamethylbenzene;Mellitene |
| Fórmula molecular | C12H18 |
| Peso Molecular | 162.2713 |
| InChI | InChI=1/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
| CAS Registry Number | 87-85-4 |
| EINECS | 201-777-0 |
| Estrutura Molecular | ![]() |
| Densidade | 0.867g/cm3 |
| Ponto de fusão | 165-168℃ |
| Ponto de ebulição | 256.6°C at 760 mmHg |
| índice de refração | 1.501 |
| O ponto de inflamação | 104.3°C |
| Pressão de vapor | 0.0245mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |