ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
879514-92-8 4-(aminomethyl)tetrahydrothiopyran-4-ol |
|
| Produkt-Name | 4-(aminomethyl)tetrahydrothiopyran-4-ol |
| Englischer Name | 4-(aminomethyl)tetrahydrothiopyran-4-ol;2H-thiopyran-4-ol, 4-(aminomethyl)tetrahydro-;4-(aminomethyl)tetrahydro-2H-Thiopyran-4-ol |
| Molekulare Formel | C6H13NOS |
| Molecular Weight | 147.2385 |
| InChl | InChI=1/C6H13NOS/c7-5-6(8)1-3-9-4-2-6/h8H,1-5,7H2 |
| CAS Registry Number | 879514-92-8 |
| Molecular Structure | ![]() |
| Dichte | 1.167g/cm3 |
| Siedepunkt | 276.5°C at 760 mmHg |
| Brechungsindex | 1.562 |
| Flammpunkt | 121°C |
| Dampfdruck | 0.000596mmHg at 25°C |
| MSDS | |