ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
879514-92-8 4-(aminomethyl)tetrahydrothiopyran-4-ol |
|
| Naam product | 4-(aminomethyl)tetrahydrothiopyran-4-ol |
| Engelse naam | 4-(aminomethyl)tetrahydrothiopyran-4-ol;2H-thiopyran-4-ol, 4-(aminomethyl)tetrahydro-;4-(aminomethyl)tetrahydro-2H-Thiopyran-4-ol |
| MF | C6H13NOS |
| Molecuulgewicht | 147.2385 |
| InChI | InChI=1/C6H13NOS/c7-5-6(8)1-3-9-4-2-6/h8H,1-5,7H2 |
| CAS-nummer | 879514-92-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.167g/cm3 |
| Kookpunt | 276.5°C at 760 mmHg |
| Brekingsindex | 1.562 |
| Vlampunt | 121°C |
| Dampdruk | 0.000596mmHg at 25°C |
| MSDS | |