ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-09-5 2-Ethylbutyric acid |
|
| Produkt-Name | 2-Ethylbutyric acid |
| Englischer Name | 2-Ethylbutyric acid;Pentane-3-carboxylic acid;Diethylacetic acid;2-Ethylbutanoic Acid;2-ethylbutanoate |
| Molekulare Formel | C6H11O2 |
| Molecular Weight | 115.1509 |
| InChl | InChI=1/C6H12O2/c1-3-5(4-2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/p-1 |
| CAS Registry Number | 88-09-5 |
| EINECS | 201-796-4 |
| Molecular Structure | ![]() |
| Schmelzpunkt | -14℃ |
| Siedepunkt | 195.4°C at 760 mmHg |
| Flammpunkt | 88.4°C |
| Wasserlöslichkeit | 18 g/L (20℃) |
| Dampfdruck | 0.18mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R21||R34:; |
| Safety Beschreibung | S26||S36/37/39||S45:; |
| MSDS | |