ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-09-5 2-Ethylbutyric acid |
|
| Nome del prodotto | 2-Ethylbutyric acid |
| Nome inglese | 2-Ethylbutyric acid;Pentane-3-carboxylic acid;Diethylacetic acid;2-Ethylbutanoic Acid;2-ethylbutanoate |
| Formula molecolare | C6H11O2 |
| Peso Molecolare | 115.1509 |
| InChI | InChI=1/C6H12O2/c1-3-5(4-2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/p-1 |
| Numero CAS | 88-09-5 |
| EINECS | 201-796-4 |
| Struttura molecolare | ![]() |
| Punto di fusione | -14℃ |
| Punto di ebollizione | 195.4°C at 760 mmHg |
| Punto d'infiammabilità | 88.4°C |
| Solubilità in acqua | 18 g/L (20℃) |
| Pressione di vapore | 0.18mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R21||R34:; |
| Sicurezza Descrizione | S26||S36/37/39||S45:; |
| MSDS | |