ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-85-7 2-sec-butyl-4,6-dinitrophenol |
|
| Produkt-Name | 2-sec-butyl-4,6-dinitrophenol |
| Englischer Name | 2-sec-butyl-4,6-dinitrophenol;dinoseb;4,6-Dinitro-2-sec butylphenol;DNBP Styrene polymerisation retarder;Inhibitor DNBP;4,6-Dinitro-2-Sec-Butylphenol;DINOSEB 100MG NEAT;2-(1-methylpropyl)-4,6-dinitro-pheno;2,4-Dinitro-6-(1-methylpropyl)phenol;2,4-dinitro-6-(1-methyl-propyl)phenol(french);2-sec-butyl-4,6-dinitro-pheno;4,6-dinitro-2-(1-methylpropyl)phenol;4,6-dinitro-2-(1-methyl-propyl)phenol;4,6-Dinitro-2-sec.butylfenol;2-(butan-2-yl)-4,6-dinitrophenol;DNBP;2,4-Dinitro-6-sec-Butylphenol;2,4-dinitro-6-sec-butyl-phenol |
| Molekulare Formel | C10H12N2O5 |
| Molecular Weight | 240.2127 |
| InChl | InChI=1/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3 |
| CAS Registry Number | 88-85-7 |
| EINECS | 201-861-7 |
| Molecular Structure | ![]() |
| Dichte | 1.348g/cm3 |
| Schmelzpunkt | 55.5℃ |
| Siedepunkt | 318.1°C at 760 mmHg |
| Brechungsindex | 1.589 |
| Flammpunkt | 132°C |
| Wasserlöslichkeit | 0.0052 g/100 mL |
| Dampfdruck | 0.000198mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R24/25||R44||R50/53||R61||R62:; |
| Safety Beschreibung | S45||S53||S60||S61:; |
| MSDS | |