ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-85-7 2-sec-butyl-4,6-dinitrophenol |
|
| 상품명칭 | 2-sec-butyl-4,6-dinitrophenol |
| 영문 이름 | 2-sec-butyl-4,6-dinitrophenol;dinoseb;4,6-Dinitro-2-sec butylphenol;DNBP Styrene polymerisation retarder;Inhibitor DNBP;4,6-Dinitro-2-Sec-Butylphenol;DINOSEB 100MG NEAT;2-(1-methylpropyl)-4,6-dinitro-pheno;2,4-Dinitro-6-(1-methylpropyl)phenol;2,4-dinitro-6-(1-methyl-propyl)phenol(french);2-sec-butyl-4,6-dinitro-pheno;4,6-dinitro-2-(1-methylpropyl)phenol;4,6-dinitro-2-(1-methyl-propyl)phenol;4,6-Dinitro-2-sec.butylfenol;2-(butan-2-yl)-4,6-dinitrophenol;DNBP;2,4-Dinitro-6-sec-Butylphenol;2,4-dinitro-6-sec-butyl-phenol |
| 분자식 | C10H12N2O5 |
| 분자량 | 240.2127 |
| InChI | InChI=1/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3 |
| cas번호 | 88-85-7 |
| EC번호 | 201-861-7 |
| 분자 구조 | ![]() |
| 밀도 | 1.348g/cm3 |
| 녹는 점 | 55.5℃ |
| 비등점 | 318.1°C at 760 mmHg |
| 굴절 지수 | 1.589 |
| 인화점 | 132°C |
| 물 용해도 | 0.0052 g/100 mL |
| 증기압 | 0.000198mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R24/25||R44||R50/53||R61||R62:; |
| 보안 규칙 | S45||S53||S60||S61:; |
| MSDS | |