ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
925889-85-6 2,6-Dibrom-9,9-dimethylfluoren |
|
| Produkt-Name | 2,6-Dibrom-9,9-dimethylfluoren |
| Synonyme | 2,6-Dibrom-9,9-dimethyl-9H-fluoren; 9H-Fluoren, 2,6-Dibrom-9,9-dimethyl- |
| Englischer Name | 2,6-dibromo-9,9-dimethyl-fluorene;2,6-Dibromo-9,9-dimethyl-9H-fluorene;9H-Fluorene, 2,6-dibromo-9,9-dimethyl- |
| Molekulare Formel | C15H12Br2 |
| Molecular Weight | 352.0638 |
| InChl | InChI=1/C15H12Br2/c1-15(2)13-6-4-9(16)7-12(13)11-5-3-10(17)8-14(11)15/h3-8H,1-2H3 |
| CAS Registry Number | 925889-85-6 |
| Molecular Structure | ![]() |
| Dichte | 1.606g/cm3 |
| Siedepunkt | 392.1°C at 760 mmHg |
| Brechungsindex | 1.635 |
| Flammpunkt | 223.4°C |
| Dampfdruck | 5.31E-06mmHg at 25°C |
| MSDS | |