ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
925889-85-6 2,6-dibroom-9,9-dimethylfluoreen |
|
| Naam product | 2,6-dibroom-9,9-dimethylfluoreen |
| Synoniemen | 2,6-dibroom-9,9-dimethyl-9H-fluoreen; 9H-Fluoreen, 2,6-dibroom-9,9-dimethyl- |
| Engelse naam | 2,6-dibromo-9,9-dimethyl-fluorene;2,6-Dibromo-9,9-dimethyl-9H-fluorene;9H-Fluorene, 2,6-dibromo-9,9-dimethyl- |
| MF | C15H12Br2 |
| Molecuulgewicht | 352.0638 |
| InChI | InChI=1/C15H12Br2/c1-15(2)13-6-4-9(16)7-12(13)11-5-3-10(17)8-14(11)15/h3-8H,1-2H3 |
| CAS-nummer | 925889-85-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.606g/cm3 |
| Kookpunt | 392.1°C at 760 mmHg |
| Brekingsindex | 1.635 |
| Vlampunt | 223.4°C |
| Dampdruk | 5.31E-06mmHg at 25°C |
| MSDS | |