ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94481-72-8 1-Deoxy-1-nitro-L-galactitol |
|
Produkt-Name | 1-Deoxy-1-nitro-L-galactitol |
Englischer Name | 1-Deoxy-1-nitro-L-galactitol;(2S,3R,4S,5R)-6-nitrohexane-1,2,3,4,5-pentol |
Molekulare Formel | C6H13NO7 |
Molecular Weight | 211.1699 |
InChl | InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4+,5+,6-/m1/s1 |
CAS Registry Number | 94481-72-8 |
EINECS | 305-399-8 |
Molecular Structure | ![]() |
Dichte | 1.632g/cm3 |
Schmelzpunkt | 142℃ |
Siedepunkt | 608.3°C at 760 mmHg |
Brechungsindex | 1.585 |
Flammpunkt | 268.9°C |
Dampfdruck | 2.45E-17mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |