ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94481-72-8 1-Deoxy-1-nitro-L-galactitol |
|
| Produkt-Name | 1-Deoxy-1-nitro-L-galactitol |
| Englischer Name | 1-Deoxy-1-nitro-L-galactitol;(2S,3R,4S,5R)-6-nitrohexane-1,2,3,4,5-pentol |
| Molekulare Formel | C6H13NO7 |
| Molecular Weight | 211.1699 |
| InChl | InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4+,5+,6-/m1/s1 |
| CAS Registry Number | 94481-72-8 |
| EINECS | 305-399-8 |
| Molecular Structure | ![]() |
| Dichte | 1.632g/cm3 |
| Schmelzpunkt | 142℃ |
| Siedepunkt | 608.3°C at 760 mmHg |
| Brechungsindex | 1.585 |
| Flammpunkt | 268.9°C |
| Dampfdruck | 2.45E-17mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |