ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94481-72-8 1-Deoxy-1-nitro-L-galactitol |
|
| Nome del prodotto | 1-Deoxy-1-nitro-L-galactitol |
| Nome inglese | 1-Deoxy-1-nitro-L-galactitol;(2S,3R,4S,5R)-6-nitrohexane-1,2,3,4,5-pentol |
| Formula molecolare | C6H13NO7 |
| Peso Molecolare | 211.1699 |
| InChI | InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4+,5+,6-/m1/s1 |
| Numero CAS | 94481-72-8 |
| EINECS | 305-399-8 |
| Struttura molecolare | ![]() |
| Densità | 1.632g/cm3 |
| Punto di fusione | 142℃ |
| Punto di ebollizione | 608.3°C at 760 mmHg |
| Indice di rifrazione | 1.585 |
| Punto d'infiammabilità | 268.9°C |
| Pressione di vapore | 2.45E-17mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |